C31H50N4O8 — CID 145381703
ethane;[4-[[2-[[3-hydroxy-2-[6-(3-methyl-2,5-dioxopyrrolidin-1-yl)hexanoylamino]propanoyl]amino]acetyl]amino]phenyl]methyl acetate;2-methylpropane (PubChem CID 145381703) has the molecular formula C31H50N4O8 and a molecular weight of 606.76 g/mol. Its IUPAC name is ethane;[4-[[2-[[3-hydroxy-2-[6-(3-methyl-2,5-dioxopyrrolidin-1-yl)hexanoylamino]propanoyl]amino]acetyl]amino]phenyl]methyl acetate;2-methylpropane.
| Compound Name | ethane;[4-[[2-[[3-hydroxy-2-[6-(3-methyl-2,5-dioxopyrrolidin-1-yl)hexanoylamino]propanoyl]amino]acetyl]amino]phenyl]methyl acetate;2-methylpropane |
|---|---|
| PubChem CID | 145381703 |
| Molecular Formula | C31H50N4O8 |
| Molecular Weight | 606.76 g/mol |
| Exact Mass | 606.36 |
| IUPAC Name | ethane;[4-[[2-[[3-hydroxy-2-[6-(3-methyl-2,5-dioxopyrrolidin-1-yl)hexanoylamino]propanoyl]amino]acetyl]amino]phenyl]methyl acetate;2-methylpropane |
| SMILES | CC.CC(=O)OCc1ccc(NC(=O)CNC(=O)C(CO)NC(=O)CCCCCN2C(=O)CC(C)C2=O)cc1.CC(C)C |
| InChI | InChI=1S/C25H34N4O8.C4H10.C2H6/c1-16-12-23(34)29(25(16)36)11-5-3-4-6-21(32)28-20(14-30)24(35)26-13-22(33)27-19-9-7-18(8-10-19)15-37-17(2)31;1-4(2)3;1-2/h7-10,16,20,30H,3-6,11-15H2,1-2H3,(H,26,35)(H,27,33)(H,28,32);4H,1-3H3;1-2H3 |
| InChIKey | HTDAGWQISZWJRB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 171.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.76 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|