C29H42N4O7 — CID 171833843
[4-[[2-[[2-[6-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)hexanoylamino]-3-methylbutanoyl]amino]acetyl]amino]phenyl]methyl acetate (PubChem CID 171833843) has the molecular formula C29H42N4O7 and a molecular weight of 558.68 g/mol. Its IUPAC name is [4-[[2-[[2-[6-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)hexanoylamino]-3-methylbutanoyl]amino]acetyl]amino]phenyl]methyl acetate.
| Compound Name | [4-[[2-[[2-[6-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)hexanoylamino]-3-methylbutanoyl]amino]acetyl]amino]phenyl]methyl acetate |
|---|---|
| PubChem CID | 171833843 |
| Molecular Formula | C29H42N4O7 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.31 |
| IUPAC Name | [4-[[2-[[2-[6-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)hexanoylamino]-3-methylbutanoyl]amino]acetyl]amino]phenyl]methyl acetate |
| SMILES | CC(=O)OCc1ccc(NC(=O)CNC(=O)C(NC(=O)CCCCCN2C(=O)CC(C(C)C)C2=O)C(C)C)cc1 |
| InChI | InChI=1S/C29H42N4O7/c1-18(2)23-15-26(37)33(29(23)39)14-8-6-7-9-24(35)32-27(19(3)4)28(38)30-16-25(36)31-22-12-10-21(11-13-22)17-40-20(5)34/h10-13,18-19,23,27H,6-9,14-17H2,1-5H3,(H,30,38)(H,31,36)(H,32,35) |
| InChIKey | KFHYQTZXDBRYOH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|