C26H37N5O7 — CID 145415979
[4-[[2-[[2-[6-(2,5-dioxopyrrolidin-1-yl)hexanoylamino]-3-methylbutanoyl]amino]acetyl]amino]phenyl]methyl N-methylcarbamate (PubChem CID 145415979) has the molecular formula C26H37N5O7 and a molecular weight of 531.61 g/mol. Its IUPAC name is [4-[[2-[[2-[6-(2,5-dioxopyrrolidin-1-yl)hexanoylamino]-3-methylbutanoyl]amino]acetyl]amino]phenyl]methyl N-methylcarbamate.
| Compound Name | [4-[[2-[[2-[6-(2,5-dioxopyrrolidin-1-yl)hexanoylamino]-3-methylbutanoyl]amino]acetyl]amino]phenyl]methyl N-methylcarbamate |
|---|---|
| PubChem CID | 145415979 |
| Molecular Formula | C26H37N5O7 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | [4-[[2-[[2-[6-(2,5-dioxopyrrolidin-1-yl)hexanoylamino]-3-methylbutanoyl]amino]acetyl]amino]phenyl]methyl N-methylcarbamate |
| SMILES | CNC(=O)OCc1ccc(NC(=O)CNC(=O)C(NC(=O)CCCCCN2C(=O)CCC2=O)C(C)C)cc1 |
| InChI | InChI=1S/C26H37N5O7/c1-17(2)24(30-20(32)7-5-4-6-14-31-22(34)12-13-23(31)35)25(36)28-15-21(33)29-19-10-8-18(9-11-19)16-38-26(37)27-3/h8-11,17,24H,4-7,12-16H2,1-3H3,(H,27,37)(H,28,36)(H,29,33)(H,30,32) |
| InChIKey | JONRMZCUVFGRRY-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 163.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|