C27H35N5O7 — CID 155468798
[4-[[2-[[(2S)-3-methyl-2-[6-(3-oxo-7-oxa-2-azabicyclo[4.1.0]hept-4-en-2-yl)hexanoylamino]butanoyl]amino]acetyl]amino]phenyl]methyl N-methylidenecarbamate (PubChem CID 155468798) has the molecular formula C27H35N5O7 and a molecular weight of 541.61 g/mol. Its IUPAC name is [4-[[2-[[(2S)-3-methyl-2-[6-(3-oxo-7-oxa-2-azabicyclo[4.1.0]hept-4-en-2-yl)hexanoylamino]butanoyl]amino]acetyl]amino]phenyl]methyl N-methylidenecarbamate.
| Compound Name | [4-[[2-[[(2S)-3-methyl-2-[6-(3-oxo-7-oxa-2-azabicyclo[4.1.0]hept-4-en-2-yl)hexanoylamino]butanoyl]amino]acetyl]amino]phenyl]methyl N-methylidenecarbamate |
|---|---|
| PubChem CID | 155468798 |
| Molecular Formula | C27H35N5O7 |
| Molecular Weight | 541.61 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | [4-[[2-[[(2S)-3-methyl-2-[6-(3-oxo-7-oxa-2-azabicyclo[4.1.0]hept-4-en-2-yl)hexanoylamino]butanoyl]amino]acetyl]amino]phenyl]methyl N-methylidenecarbamate |
| SMILES | C=NC(=O)OCc1ccc(NC(=O)CNC(=O)[C@@H](NC(=O)CCCCCN2C(=O)C=CC3OC32)C(C)C)cc1 |
| InChI | InChI=1S/C27H35N5O7/c1-17(2)24(31-21(33)7-5-4-6-14-32-23(35)13-12-20-26(32)39-20)25(36)29-15-22(34)30-19-10-8-18(9-11-19)16-38-27(37)28-3/h8-13,17,20,24,26H,3-7,14-16H2,1-2H3,(H,29,36)(H,30,34)(H,31,33)/t20?,24-,26?/m0/s1 |
| InChIKey | XVXXMBZWWLTQMN-REXMIWGRSA-N |
| XLogP | 1.90 |
| TPSA | 158.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.61 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|