C18H24BN3O5 — CID 177226802
CID 177226802 (PubChem CID 177226802) has the molecular formula C18H24BN3O5 and a molecular weight of 373.22 g/mol.
| Compound Name | CID 177226802 |
|---|---|
| PubChem CID | 177226802 |
| Molecular Formula | C18H24BN3O5 |
| Molecular Weight | 373.22 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | — |
| SMILES | [B]C(=O)OCc1ccc(NC(=O)CNC(=O)C(NC(=O)CC)C(C)C)cc1 |
| InChI | InChI=1S/C18H24BN3O5/c1-4-14(23)22-16(11(2)3)17(25)20-9-15(24)21-13-7-5-12(6-8-13)10-27-18(19)26/h5-8,11,16H,4,9-10H2,1-3H3,(H,20,25)(H,21,24)(H,22,23) |
| InChIKey | BXLFZZCHLAHEAU-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.22 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|