C25H39BN4O6 — CID 163384989
CID 163384989 (PubChem CID 163384989) has the molecular formula C25H39BN4O6 and a molecular weight of 502.42 g/mol.
| Compound Name | CID 163384989 |
|---|---|
| PubChem CID | 163384989 |
| Molecular Formula | C25H39BN4O6 |
| Molecular Weight | 502.42 g/mol |
| Exact Mass | 502.30 |
| IUPAC Name | — |
| SMILES | [B]C(=O)OCc1ccc(NC(=O)CNC(=O)C(NC(=O)CC(C)(C)OCCC(C)(C)N)C(C)C)cc1 |
| InChI | InChI=1S/C25H39BN4O6/c1-16(2)21(30-19(31)13-25(5,6)36-12-11-24(3,4)27)22(33)28-14-20(32)29-18-9-7-17(8-10-18)15-35-23(26)34/h7-10,16,21H,11-15,27H2,1-6H3,(H,28,33)(H,29,32)(H,30,31) |
| InChIKey | ORUUPINGSQSLJM-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 148.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|