C26H44N4O7S — CID 163384664
[4-[[2-[[2-[[3-(3-amino-3-methylbutoxy)-3-sulfanylbutanoyl]amino]-3-methylbutanoyl]amino]acetyl]amino]phenyl]methyl hydrogen carbonate;ethane (PubChem CID 163384664) has the molecular formula C26H44N4O7S and a molecular weight of 556.73 g/mol. Its IUPAC name is [4-[[2-[[2-[[3-(3-amino-3-methylbutoxy)-3-sulfanylbutanoyl]amino]-3-methylbutanoyl]amino]acetyl]amino]phenyl]methyl hydrogen carbonate;ethane.
| Compound Name | [4-[[2-[[2-[[3-(3-amino-3-methylbutoxy)-3-sulfanylbutanoyl]amino]-3-methylbutanoyl]amino]acetyl]amino]phenyl]methyl hydrogen carbonate;ethane |
|---|---|
| PubChem CID | 163384664 |
| Molecular Formula | C26H44N4O7S |
| Molecular Weight | 556.73 g/mol |
| Exact Mass | 556.29 |
| IUPAC Name | [4-[[2-[[2-[[3-(3-amino-3-methylbutoxy)-3-sulfanylbutanoyl]amino]-3-methylbutanoyl]amino]acetyl]amino]phenyl]methyl hydrogen carbonate;ethane |
| SMILES | CC.CC(C)C(NC(=O)CC(C)(S)OCCC(C)(C)N)C(=O)NCC(=O)Nc1ccc(COC(=O)O)cc1 |
| InChI | InChI=1S/C24H38N4O7S.C2H6/c1-15(2)20(28-18(29)12-24(5,36)35-11-10-23(3,4)25)21(31)26-13-19(30)27-17-8-6-16(7-9-17)14-34-22(32)33;1-2/h6-9,15,20,36H,10-14,25H2,1-5H3,(H,26,31)(H,27,30)(H,28,29)(H,32,33);1-2H3 |
| InChIKey | RWYDXESWPJEUBY-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 169.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.73 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|