C26H36N4O9 — CID 145098173
[4-[[2-[[3-methyl-2-[[2-[2-[2-[[(Z)-4-oxobut-2-enoyl]amino]ethoxy]ethoxy]acetyl]amino]butanoyl]amino]acetyl]amino]phenyl]methyl acetate (PubChem CID 145098173) has the molecular formula C26H36N4O9 and a molecular weight of 548.59 g/mol. Its IUPAC name is [4-[[2-[[3-methyl-2-[[2-[2-[2-[[(Z)-4-oxobut-2-enoyl]amino]ethoxy]ethoxy]acetyl]amino]butanoyl]amino]acetyl]amino]phenyl]methyl acetate.
| Compound Name | [4-[[2-[[3-methyl-2-[[2-[2-[2-[[(Z)-4-oxobut-2-enoyl]amino]ethoxy]ethoxy]acetyl]amino]butanoyl]amino]acetyl]amino]phenyl]methyl acetate |
|---|---|
| PubChem CID | 145098173 |
| Molecular Formula | C26H36N4O9 |
| Molecular Weight | 548.59 g/mol |
| Exact Mass | 548.25 |
| IUPAC Name | [4-[[2-[[3-methyl-2-[[2-[2-[2-[[(Z)-4-oxobut-2-enoyl]amino]ethoxy]ethoxy]acetyl]amino]butanoyl]amino]acetyl]amino]phenyl]methyl acetate |
| SMILES | CC(=O)OCc1ccc(NC(=O)CNC(=O)C(NC(=O)COCCOCCNC(=O)/C=C\C=O)C(C)C)cc1 |
| InChI | InChI=1S/C26H36N4O9/c1-18(2)25(30-24(35)17-38-14-13-37-12-10-27-22(33)5-4-11-31)26(36)28-15-23(34)29-21-8-6-20(7-9-21)16-39-19(3)32/h4-9,11,18,25H,10,12-17H2,1-3H3,(H,27,33)(H,28,36)(H,29,34)(H,30,35)/b5-4- |
| InChIKey | UEKGYELLEZNVPD-PLNGDYQASA-N |
| XLogP | -0.15 |
| TPSA | 178.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.59 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|