C17H26N4O3 — CID 166778026
[4-[[2-[[3-methyl-2-(methylamino)butanoyl]amino]acetyl]amino]phenyl]methyl N-methylmethanimidate (PubChem CID 166778026) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is [4-[[2-[[3-methyl-2-(methylamino)butanoyl]amino]acetyl]amino]phenyl]methyl N-methylmethanimidate.
| Compound Name | [4-[[2-[[3-methyl-2-(methylamino)butanoyl]amino]acetyl]amino]phenyl]methyl N-methylmethanimidate |
|---|---|
| PubChem CID | 166778026 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | [4-[[2-[[3-methyl-2-(methylamino)butanoyl]amino]acetyl]amino]phenyl]methyl N-methylmethanimidate |
| SMILES | C/N=C/OCc1ccc(NC(=O)CNC(=O)C(NC)C(C)C)cc1 |
| InChI | InChI=1S/C17H26N4O3/c1-12(2)16(19-4)17(23)20-9-15(22)21-14-7-5-13(6-8-14)10-24-11-18-3/h5-8,11-12,16,19H,9-10H2,1-4H3,(H,20,23)(H,21,22)/b18-11+ |
| InChIKey | MJTYSDSAJVOVOC-WOJGMQOQSA-N |
| XLogP | 1.16 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|