C19H31N5O5 — CID 176987623
[4-[[2-[(2-amino-3-methylbutanoyl)amino]acetyl]amino]phenyl]methyl formate;propylurea (PubChem CID 176987623) has the molecular formula C19H31N5O5 and a molecular weight of 409.49 g/mol. Its IUPAC name is [4-[[2-[(2-amino-3-methylbutanoyl)amino]acetyl]amino]phenyl]methyl formate;propylurea.
| Compound Name | [4-[[2-[(2-amino-3-methylbutanoyl)amino]acetyl]amino]phenyl]methyl formate;propylurea |
|---|---|
| PubChem CID | 176987623 |
| Molecular Formula | C19H31N5O5 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | [4-[[2-[(2-amino-3-methylbutanoyl)amino]acetyl]amino]phenyl]methyl formate;propylurea |
| SMILES | CC(C)C(N)C(=O)NCC(=O)Nc1ccc(COC=O)cc1.CCCNC(N)=O |
| InChI | InChI=1S/C15H21N3O4.C4H10N2O/c1-10(2)14(16)15(21)17-7-13(20)18-12-5-3-11(4-6-12)8-22-9-19;1-2-3-6-4(5)7/h3-6,9-10,14H,7-8,16H2,1-2H3,(H,17,21)(H,18,20);2-3H2,1H3,(H3,5,6,7) |
| InChIKey | BEJHUJUUEGNLBU-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 165.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|