C19H35N5O4 — CID 142601689
2-formamido-N-[4-(hydroxymethyl)phenyl]acetamide;3-methylbutan-2-amine;propylurea (PubChem CID 142601689) has the molecular formula C19H35N5O4 and a molecular weight of 397.52 g/mol. Its IUPAC name is 2-formamido-N-[4-(hydroxymethyl)phenyl]acetamide;3-methylbutan-2-amine;propylurea.
| Compound Name | 2-formamido-N-[4-(hydroxymethyl)phenyl]acetamide;3-methylbutan-2-amine;propylurea |
|---|---|
| PubChem CID | 142601689 |
| Molecular Formula | C19H35N5O4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | 2-formamido-N-[4-(hydroxymethyl)phenyl]acetamide;3-methylbutan-2-amine;propylurea |
| SMILES | CC(C)C(C)N.CCCNC(N)=O.O=CNCC(=O)Nc1ccc(CO)cc1 |
| InChI | InChI=1S/C10H12N2O3.C5H13N.C4H10N2O/c13-6-8-1-3-9(4-2-8)12-10(15)5-11-7-14;1-4(2)5(3)6;1-2-3-6-4(5)7/h1-4,7,13H,5-6H2,(H,11,14)(H,12,15);4-5H,6H2,1-3H3;2-3H2,1H3,(H3,5,6,7) |
| InChIKey | FCXCIBRCSKRAGB-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 159.57 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|