C20H30N4O5 — CID 171804617
[4-[[2-[[3-methyl-2-[[2-(propan-2-ylamino)acetyl]amino]butanoyl]amino]acetyl]amino]phenyl]methyl formate (PubChem CID 171804617) has the molecular formula C20H30N4O5 and a molecular weight of 406.48 g/mol. Its IUPAC name is [4-[[2-[[3-methyl-2-[[2-(propan-2-ylamino)acetyl]amino]butanoyl]amino]acetyl]amino]phenyl]methyl formate.
| Compound Name | [4-[[2-[[3-methyl-2-[[2-(propan-2-ylamino)acetyl]amino]butanoyl]amino]acetyl]amino]phenyl]methyl formate |
|---|---|
| PubChem CID | 171804617 |
| Molecular Formula | C20H30N4O5 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | [4-[[2-[[3-methyl-2-[[2-(propan-2-ylamino)acetyl]amino]butanoyl]amino]acetyl]amino]phenyl]methyl formate |
| SMILES | CC(C)NCC(=O)NC(C(=O)NCC(=O)Nc1ccc(COC=O)cc1)C(C)C |
| InChI | InChI=1S/C20H30N4O5/c1-13(2)19(24-18(27)9-21-14(3)4)20(28)22-10-17(26)23-16-7-5-15(6-8-16)11-29-12-25/h5-8,12-14,19,21H,9-11H2,1-4H3,(H,22,28)(H,23,26)(H,24,27) |
| InChIKey | OXFOFEBSZWOVCP-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|