C23H28N4O7 — CID 166778025
[4-[[2-[[2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-methylbutanoyl]amino]acetyl]amino]-2-ethylphenyl]methyl formate (PubChem CID 166778025) has the molecular formula C23H28N4O7 and a molecular weight of 472.50 g/mol. Its IUPAC name is [4-[[2-[[2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-methylbutanoyl]amino]acetyl]amino]-2-ethylphenyl]methyl formate.
| Compound Name | [4-[[2-[[2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-methylbutanoyl]amino]acetyl]amino]-2-ethylphenyl]methyl formate |
|---|---|
| PubChem CID | 166778025 |
| Molecular Formula | C23H28N4O7 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | [4-[[2-[[2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-methylbutanoyl]amino]acetyl]amino]-2-ethylphenyl]methyl formate |
| SMILES | CCc1cc(NC(=O)CNC(=O)C(NC(=O)CN2C(=O)C=CC2=O)C(C)C)ccc1COC=O |
| InChI | InChI=1S/C23H28N4O7/c1-4-15-9-17(6-5-16(15)12-34-13-28)25-18(29)10-24-23(33)22(14(2)3)26-19(30)11-27-20(31)7-8-21(27)32/h5-9,13-14,22H,4,10-12H2,1-3H3,(H,24,33)(H,25,29)(H,26,30) |
| InChIKey | STPIVZMDOGZKDX-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|