C35H44N4O10 — CID 145415793
[4-[[2-[[2-[[(2S)-2-(2,5-dioxopyrrol-1-yl)-3-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]propanoyl]amino]-3-methylbutanoyl]amino]acetyl]amino]-2-ethylphenyl]methyl formate (PubChem CID 145415793) has the molecular formula C35H44N4O10 and a molecular weight of 680.75 g/mol. Its IUPAC name is [4-[[2-[[2-[[(2S)-2-(2,5-dioxopyrrol-1-yl)-3-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]propanoyl]amino]-3-methylbutanoyl]amino]acetyl]amino]-2-ethylphenyl]methyl formate.
| Compound Name | [4-[[2-[[2-[[(2S)-2-(2,5-dioxopyrrol-1-yl)-3-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]propanoyl]amino]-3-methylbutanoyl]amino]acetyl]amino]-2-ethylphenyl]methyl formate |
|---|---|
| PubChem CID | 145415793 |
| Molecular Formula | C35H44N4O10 |
| Molecular Weight | 680.75 g/mol |
| Exact Mass | 680.31 |
| IUPAC Name | [4-[[2-[[2-[[(2S)-2-(2,5-dioxopyrrol-1-yl)-3-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]propanoyl]amino]-3-methylbutanoyl]amino]acetyl]amino]-2-ethylphenyl]methyl formate |
| SMILES | CCc1cc(NC(=O)CNC(=O)C(NC(=O)[C@H](Cc2ccc(OCCOCCOC)cc2)N2C(=O)C=CC2=O)C(C)C)ccc1COC=O |
| InChI | InChI=1S/C35H44N4O10/c1-5-25-19-27(9-8-26(25)21-48-22-40)37-30(41)20-36-35(45)33(23(2)3)38-34(44)29(39-31(42)12-13-32(39)43)18-24-6-10-28(11-7-24)49-17-16-47-15-14-46-4/h6-13,19,22-23,29,33H,5,14-18,20-21H2,1-4H3,(H,36,45)(H,37,41)(H,38,44)/t29-,33?/m0/s1 |
| InChIKey | FEZLXZMUWFTHTM-WXTKOERCSA-N |
| XLogP | 1.70 |
| TPSA | 178.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.75 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|