C26H38N4O7 — CID 178169109
[4-[[2-[[2-[6-[butanoyl(formyl)amino]hexanoylamino]-3-methylbutanoyl]amino]acetyl]amino]phenyl]methyl formate (PubChem CID 178169109) has the molecular formula C26H38N4O7 and a molecular weight of 518.61 g/mol. Its IUPAC name is [4-[[2-[[2-[6-[butanoyl(formyl)amino]hexanoylamino]-3-methylbutanoyl]amino]acetyl]amino]phenyl]methyl formate.
| Compound Name | [4-[[2-[[2-[6-[butanoyl(formyl)amino]hexanoylamino]-3-methylbutanoyl]amino]acetyl]amino]phenyl]methyl formate |
|---|---|
| PubChem CID | 178169109 |
| Molecular Formula | C26H38N4O7 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | [4-[[2-[[2-[6-[butanoyl(formyl)amino]hexanoylamino]-3-methylbutanoyl]amino]acetyl]amino]phenyl]methyl formate |
| SMILES | CCCC(=O)N(C=O)CCCCCC(=O)NC(C(=O)NCC(=O)Nc1ccc(COC=O)cc1)C(C)C |
| InChI | InChI=1S/C26H38N4O7/c1-4-8-24(35)30(17-31)14-7-5-6-9-22(33)29-25(19(2)3)26(36)27-15-23(34)28-21-12-10-20(11-13-21)16-37-18-32/h10-13,17-19,25H,4-9,14-16H2,1-3H3,(H,27,36)(H,28,34)(H,29,33) |
| InChIKey | VTICHCCXYABLNR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|