C20H25NO6 — CID 121386831
1-[1-[4-[2-(2-methoxyethoxy)ethoxy]-3-methylphenyl]-3-oxobutan-2-yl]pyrrole-2,5-dione (PubChem CID 121386831) has the molecular formula C20H25NO6 and a molecular weight of 375.42 g/mol. Its IUPAC name is 1-[1-[4-[2-(2-methoxyethoxy)ethoxy]-3-methylphenyl]-3-oxobutan-2-yl]pyrrole-2,5-dione.
| Compound Name | 1-[1-[4-[2-(2-methoxyethoxy)ethoxy]-3-methylphenyl]-3-oxobutan-2-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 121386831 |
| Molecular Formula | C20H25NO6 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 1-[1-[4-[2-(2-methoxyethoxy)ethoxy]-3-methylphenyl]-3-oxobutan-2-yl]pyrrole-2,5-dione |
| SMILES | COCCOCCOc1ccc(CC(C(C)=O)N2C(=O)C=CC2=O)cc1C |
| InChI | InChI=1S/C20H25NO6/c1-14-12-16(4-5-18(14)27-11-10-26-9-8-25-3)13-17(15(2)22)21-19(23)6-7-20(21)24/h4-7,12,17H,8-11,13H2,1-3H3 |
| InChIKey | ULXXWJMHZRYHRM-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|