C19H29NO5 — CID 158072710
N-[1-[4-[2-(2-methoxyethoxy)ethoxy]-3-methylphenyl]-3-oxobutan-2-yl]propanamide (PubChem CID 158072710) has the molecular formula C19H29NO5 and a molecular weight of 351.44 g/mol. Its IUPAC name is N-[1-[4-[2-(2-methoxyethoxy)ethoxy]-3-methylphenyl]-3-oxobutan-2-yl]propanamide.
| Compound Name | N-[1-[4-[2-(2-methoxyethoxy)ethoxy]-3-methylphenyl]-3-oxobutan-2-yl]propanamide |
|---|---|
| PubChem CID | 158072710 |
| Molecular Formula | C19H29NO5 |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | N-[1-[4-[2-(2-methoxyethoxy)ethoxy]-3-methylphenyl]-3-oxobutan-2-yl]propanamide |
| SMILES | CCC(=O)NC(Cc1ccc(OCCOCCOC)c(C)c1)C(C)=O |
| InChI | InChI=1S/C19H29NO5/c1-5-19(22)20-17(15(3)21)13-16-6-7-18(14(2)12-16)25-11-10-24-9-8-23-4/h6-7,12,17H,5,8-11,13H2,1-4H3,(H,20,22) |
| InChIKey | CMFCTRPLLRLMNU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|