C21H36O8 — CID 59950660
2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-4,5-dimethylphenoxy]ethoxy]ethoxy]ethanol (PubChem CID 59950660) has the molecular formula C21H36O8 and a molecular weight of 416.51 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-4,5-dimethylphenoxy]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-4,5-dimethylphenoxy]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 59950660 |
| Molecular Formula | C21H36O8 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-4,5-dimethylphenoxy]ethoxy]ethoxy]ethanol |
| SMILES | COCCOCCOCCOc1cc(C)c(C)cc1OCCOCCOCCO |
| InChI | InChI=1S/C21H36O8/c1-18-16-20(28-14-12-26-9-8-24-5-4-22)21(17-19(18)2)29-15-13-27-11-10-25-7-6-23-3/h16-17,22H,4-15H2,1-3H3 |
| InChIKey | XBXMJTHYQITQTO-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|