C13H20O3 — CID 61076408
2-[2-(2,3,5-trimethylphenoxy)ethoxy]ethanol (PubChem CID 61076408) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is 2-[2-(2,3,5-trimethylphenoxy)ethoxy]ethanol.
| Compound Name | 2-[2-(2,3,5-trimethylphenoxy)ethoxy]ethanol |
|---|---|
| PubChem CID | 61076408 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 2-[2-(2,3,5-trimethylphenoxy)ethoxy]ethanol |
| SMILES | Cc1cc(C)c(C)c(OCCOCCO)c1 |
| InChI | InChI=1S/C13H20O3/c1-10-8-11(2)12(3)13(9-10)16-7-6-15-5-4-14/h8-9,14H,4-7H2,1-3H3 |
| InChIKey | FKRVVMZPLZXCQG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|