C13H21NO3 — CID 63639091
2-[2-[2-(1-aminoethyl)-5-methylphenoxy]ethoxy]ethanol (PubChem CID 63639091) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is 2-[2-[2-(1-aminoethyl)-5-methylphenoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-(1-aminoethyl)-5-methylphenoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 63639091 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 2-[2-[2-(1-aminoethyl)-5-methylphenoxy]ethoxy]ethanol |
| SMILES | Cc1ccc(C(C)N)c(OCCOCCO)c1 |
| InChI | InChI=1S/C13H21NO3/c1-10-3-4-12(11(2)14)13(9-10)17-8-7-16-6-5-15/h3-4,9,11,15H,5-8,14H2,1-2H3 |
| InChIKey | FVTTUWDSIFZAEU-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|