C15H25NO — CID 78946993
(1R)-1-[2-(3,3-dimethylbutoxy)-4-methylphenyl]ethanamine (PubChem CID 78946993) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is (1R)-1-[2-(3,3-dimethylbutoxy)-4-methylphenyl]ethanamine.
| Compound Name | (1R)-1-[2-(3,3-dimethylbutoxy)-4-methylphenyl]ethanamine |
|---|---|
| PubChem CID | 78946993 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | (1R)-1-[2-(3,3-dimethylbutoxy)-4-methylphenyl]ethanamine |
| SMILES | Cc1ccc([C@@H](C)N)c(OCCC(C)(C)C)c1 |
| InChI | InChI=1S/C15H25NO/c1-11-6-7-13(12(2)16)14(10-11)17-9-8-15(3,4)5/h6-7,10,12H,8-9,16H2,1-5H3/t12-/m1/s1 |
| InChIKey | GVROFKIVKMGNPO-GFCCVEGCSA-N |
| XLogP | 3.83 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |