C13H21NO — CID 63639629
(1R)-1-(2-butoxy-4-methylphenyl)ethanamine (PubChem CID 63639629) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is (1R)-1-(2-butoxy-4-methylphenyl)ethanamine.
| Compound Name | (1R)-1-(2-butoxy-4-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 63639629 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | (1R)-1-(2-butoxy-4-methylphenyl)ethanamine |
| SMILES | CCCCOc1cc(C)ccc1[C@@H](C)N |
| InChI | InChI=1S/C13H21NO/c1-4-5-8-15-13-9-10(2)6-7-12(13)11(3)14/h6-7,9,11H,4-5,8,14H2,1-3H3/t11-/m1/s1 |
| InChIKey | CYHIXROCGMAPSK-LLVKDONJSA-N |
| XLogP | 3.19 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|