C16H27NO2 — CID 64805200
2-(propan-2-ylamino)-4-(2,3,5-trimethylphenoxy)butan-1-ol (PubChem CID 64805200) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is 2-(propan-2-ylamino)-4-(2,3,5-trimethylphenoxy)butan-1-ol.
| Compound Name | 2-(propan-2-ylamino)-4-(2,3,5-trimethylphenoxy)butan-1-ol |
|---|---|
| PubChem CID | 64805200 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | 2-(propan-2-ylamino)-4-(2,3,5-trimethylphenoxy)butan-1-ol |
| SMILES | Cc1cc(C)c(C)c(OCCC(CO)NC(C)C)c1 |
| InChI | InChI=1S/C16H27NO2/c1-11(2)17-15(10-18)6-7-19-16-9-12(3)8-13(4)14(16)5/h8-9,11,15,17-18H,6-7,10H2,1-5H3 |
| InChIKey | CWBUCNFGBKAFIV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |