C38H69O16+ — CID 90716584
2-[2-[2-[3-methyl-4-[3,4,5-tris[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]butoxy]ethoxy]ethoxy]ethanol (PubChem CID 90716584) has the molecular formula C38H69O16+ and a molecular weight of 781.95 g/mol. Its IUPAC name is 2-[2-[2-[3-methyl-4-[3,4,5-tris[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]butoxy]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[3-methyl-4-[3,4,5-tris[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]butoxy]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 90716584 |
| Molecular Formula | C38H69O16+ |
| Molecular Weight | 781.95 g/mol |
| Exact Mass | 781.46 |
| IUPAC Name | 2-[2-[2-[3-methyl-4-[3,4,5-tris[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]butoxy]ethoxy]ethoxy]ethanol |
| SMILES | COCCOCCOCCOc1cc(C[C+](C)CCOCCOCCOCCO)cc(OCCOCCOCCOC)c1OCCOCCOCCOC |
| InChI | InChI=1S/C38H69O16/c1-34(5-7-43-15-17-48-18-16-44-8-6-39)31-35-32-36(52-28-25-49-22-19-45-12-9-40-2)38(54-30-27-51-24-21-47-14-11-42-4)37(33-35)53-29-26-50-23-20-46-13-10-41-3/h32-33,39H,5-31H2,1-4H3/q+1 |
| InChIKey | XVCAJBWQPDSLQB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 158.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.95 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|