C35H62O15 — CID 143391101
1-[3,5-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-4-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]phenyl]ethanone (PubChem CID 143391101) has the molecular formula C35H62O15 and a molecular weight of 722.87 g/mol. Its IUPAC name is 1-[3,5-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-4-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]phenyl]ethanone.
| Compound Name | 1-[3,5-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-4-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 143391101 |
| Molecular Formula | C35H62O15 |
| Molecular Weight | 722.87 g/mol |
| Exact Mass | 722.41 |
| IUPAC Name | 1-[3,5-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]-4-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]phenyl]ethanone |
| SMILES | CCCOCCOCCOCCOc1c(OCCOCCOCCOCCOC)cc(C(C)=O)cc1OCCOCCOCCOCCOC |
| InChI | InChI=1S/C35H62O15/c1-5-6-39-11-12-42-19-22-47-25-28-50-35-33(48-26-23-45-20-17-43-15-13-40-9-7-37-3)29-32(31(2)36)30-34(35)49-27-24-46-21-18-44-16-14-41-10-8-38-4/h29-30H,5-28H2,1-4H3 |
| InChIKey | XZUOZXCWHYXGBC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 146.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.87 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|