C32H59N3O10 — CID 58858900
1-[3,4,5-tris[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethoxy]phenyl]ethanone (PubChem CID 58858900) has the molecular formula C32H59N3O10 and a molecular weight of 645.84 g/mol. Its IUPAC name is 1-[3,4,5-tris[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethoxy]phenyl]ethanone.
| Compound Name | 1-[3,4,5-tris[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 58858900 |
| Molecular Formula | C32H59N3O10 |
| Molecular Weight | 645.84 g/mol |
| Exact Mass | 645.42 |
| IUPAC Name | 1-[3,4,5-tris[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethoxy]phenyl]ethanone |
| SMILES | CC(=O)c1cc(OCCOCCOCCN(C)C)c(OCCOCCOCCN(C)C)c(OCCOCCOCCN(C)C)c1 |
| InChI | InChI=1S/C32H59N3O10/c1-28(36)29-26-30(43-23-20-40-17-14-37-11-8-33(2)3)32(45-25-22-42-19-16-39-13-10-35(6)7)31(27-29)44-24-21-41-18-15-38-12-9-34(4)5/h26-27H,8-25H2,1-7H3 |
| InChIKey | IVGCJWYQJMZDOW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 109.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.84 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|