C17H29NO2 — CID 2181239
2-[2-(4-tert-butyl-2-methylphenoxy)ethoxy]-N,N-dimethylethanamine (PubChem CID 2181239) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is 2-[2-(4-tert-butyl-2-methylphenoxy)ethoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[2-(4-tert-butyl-2-methylphenoxy)ethoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 2181239 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | 2-[2-(4-tert-butyl-2-methylphenoxy)ethoxy]-N,N-dimethylethanamine |
| SMILES | Cc1cc(C(C)(C)C)ccc1OCCOCCN(C)C |
| InChI | InChI=1S/C17H29NO2/c1-14-13-15(17(2,3)4)7-8-16(14)20-12-11-19-10-9-18(5)6/h7-8,13H,9-12H2,1-6H3 |
| InChIKey | NFONARMHKBPZQE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|