C12H19ClINO — CID 6457208
3-(4-iodo-2-methylphenoxy)-N,N-dimethylpropan-1-amine;hydrochloride (PubChem CID 6457208) has the molecular formula C12H19ClINO and a molecular weight of 355.65 g/mol. Its IUPAC name is 3-(4-iodo-2-methylphenoxy)-N,N-dimethylpropan-1-amine;hydrochloride.
| Compound Name | 3-(4-iodo-2-methylphenoxy)-N,N-dimethylpropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 6457208 |
| Molecular Formula | C12H19ClINO |
| Molecular Weight | 355.65 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | 3-(4-iodo-2-methylphenoxy)-N,N-dimethylpropan-1-amine;hydrochloride |
| SMILES | Cc1cc(I)ccc1OCCCN(C)C.Cl |
| InChI | InChI=1S/C12H18INO.ClH/c1-10-9-11(13)5-6-12(10)15-8-4-7-14(2)3;/h5-6,9H,4,7-8H2,1-3H3;1H |
| InChIKey | CHYFAAVQCQNZFG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.65 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|