C11H16BrNO — CID 20679125
2-(4-bromo-2-methylphenoxy)-N,N-dimethylethanamine (PubChem CID 20679125) has the molecular formula C11H16BrNO and a molecular weight of 258.16 g/mol. Its IUPAC name is 2-(4-bromo-2-methylphenoxy)-N,N-dimethylethanamine.
| Compound Name | 2-(4-bromo-2-methylphenoxy)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 20679125 |
| Molecular Formula | C11H16BrNO |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 2-(4-bromo-2-methylphenoxy)-N,N-dimethylethanamine |
| SMILES | Cc1cc(Br)ccc1OCCN(C)C |
| InChI | InChI=1S/C11H16BrNO/c1-9-8-10(12)4-5-11(9)14-7-6-13(2)3/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | VJYPNNLRRQJOMQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |