C11H17BrN2O3S — CID 90022792
N-[5-bromo-2-[2-(dimethylamino)ethoxy]phenyl]methanesulfonamide (PubChem CID 90022792) has the molecular formula C11H17BrN2O3S and a molecular weight of 337.24 g/mol. Its IUPAC name is N-[5-bromo-2-[2-(dimethylamino)ethoxy]phenyl]methanesulfonamide.
| Compound Name | N-[5-bromo-2-[2-(dimethylamino)ethoxy]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 90022792 |
| Molecular Formula | C11H17BrN2O3S |
| Molecular Weight | 337.24 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | N-[5-bromo-2-[2-(dimethylamino)ethoxy]phenyl]methanesulfonamide |
| SMILES | CN(C)CCOc1ccc(Br)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C11H17BrN2O3S/c1-14(2)6-7-17-11-5-4-9(12)8-10(11)13-18(3,15)16/h4-5,8,13H,6-7H2,1-3H3 |
| InChIKey | STDCIOYESAYEES-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.24 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |