C11H15BrClNO — CID 114525429
3-(5-bromo-2-chlorophenoxy)-N,N-dimethylpropan-1-amine (PubChem CID 114525429) has the molecular formula C11H15BrClNO and a molecular weight of 292.60 g/mol. Its IUPAC name is 3-(5-bromo-2-chlorophenoxy)-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(5-bromo-2-chlorophenoxy)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 114525429 |
| Molecular Formula | C11H15BrClNO |
| Molecular Weight | 292.60 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | 3-(5-bromo-2-chlorophenoxy)-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCOc1cc(Br)ccc1Cl |
| InChI | InChI=1S/C11H15BrClNO/c1-14(2)6-3-7-15-11-8-9(12)4-5-10(11)13/h4-5,8H,3,6-7H2,1-2H3 |
| InChIKey | HFJDCKHDSQCENV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.60 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|