C10H9BrClF3O — CID 115514016
4-bromo-1-chloro-2-(4,4,4-trifluorobutoxy)benzene (PubChem CID 115514016) has the molecular formula C10H9BrClF3O and a molecular weight of 317.53 g/mol. Its IUPAC name is 4-bromo-1-chloro-2-(4,4,4-trifluorobutoxy)benzene.
| Compound Name | 4-bromo-1-chloro-2-(4,4,4-trifluorobutoxy)benzene |
|---|---|
| PubChem CID | 115514016 |
| Molecular Formula | C10H9BrClF3O |
| Molecular Weight | 317.53 g/mol |
| Exact Mass | 315.95 |
| IUPAC Name | 4-bromo-1-chloro-2-(4,4,4-trifluorobutoxy)benzene |
| SMILES | FC(F)(F)CCCOc1cc(Br)ccc1Cl |
| InChI | InChI=1S/C10H9BrClF3O/c11-7-2-3-8(12)9(6-7)16-5-1-4-10(13,14)15/h2-3,6H,1,4-5H2 |
| InChIKey | VKIYQELECVBJJW-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.53 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|