C11H10BrF3O2 — CID 115514041
3-bromo-4-(4,4,4-trifluorobutoxy)benzaldehyde (PubChem CID 115514041) has the molecular formula C11H10BrF3O2 and a molecular weight of 311.10 g/mol. Its IUPAC name is 3-bromo-4-(4,4,4-trifluorobutoxy)benzaldehyde.
| Compound Name | 3-bromo-4-(4,4,4-trifluorobutoxy)benzaldehyde |
|---|---|
| PubChem CID | 115514041 |
| Molecular Formula | C11H10BrF3O2 |
| Molecular Weight | 311.10 g/mol |
| Exact Mass | 309.98 |
| IUPAC Name | 3-bromo-4-(4,4,4-trifluorobutoxy)benzaldehyde |
| SMILES | O=Cc1ccc(OCCCC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C11H10BrF3O2/c12-9-6-8(7-16)2-3-10(9)17-5-1-4-11(13,14)15/h2-3,6-7H,1,4-5H2 |
| InChIKey | ZDJCDFZHIXSIMJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.10 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|