C11H12BrF3O2 — CID 113443609
2-bromo-4-methoxy-1-(4,4,4-trifluorobutoxy)benzene (PubChem CID 113443609) has the molecular formula C11H12BrF3O2 and a molecular weight of 313.11 g/mol. Its IUPAC name is 2-bromo-4-methoxy-1-(4,4,4-trifluorobutoxy)benzene.
| Compound Name | 2-bromo-4-methoxy-1-(4,4,4-trifluorobutoxy)benzene |
|---|---|
| PubChem CID | 113443609 |
| Molecular Formula | C11H12BrF3O2 |
| Molecular Weight | 313.11 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | 2-bromo-4-methoxy-1-(4,4,4-trifluorobutoxy)benzene |
| SMILES | COc1ccc(OCCCC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C11H12BrF3O2/c1-16-8-3-4-10(9(12)7-8)17-6-2-5-11(13,14)15/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | PXHXBVUWMFNBJU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.11 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|