C9H12BrNO4S — CID 104708667
2-(2-bromo-4-methoxyphenoxy)ethanesulfonamide (PubChem CID 104708667) has the molecular formula C9H12BrNO4S and a molecular weight of 310.17 g/mol. Its IUPAC name is 2-(2-bromo-4-methoxyphenoxy)ethanesulfonamide.
| Compound Name | 2-(2-bromo-4-methoxyphenoxy)ethanesulfonamide |
|---|---|
| PubChem CID | 104708667 |
| Molecular Formula | C9H12BrNO4S |
| Molecular Weight | 310.17 g/mol |
| Exact Mass | 308.97 |
| IUPAC Name | 2-(2-bromo-4-methoxyphenoxy)ethanesulfonamide |
| SMILES | COc1ccc(OCCS(N)(=O)=O)c(Br)c1 |
| InChI | InChI=1S/C9H12BrNO4S/c1-14-7-2-3-9(8(10)6-7)15-4-5-16(11,12)13/h2-3,6H,4-5H2,1H3,(H2,11,12,13) |
| InChIKey | BVFAMQOTVJGLPW-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.17 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |