C9H12BrNO3S — CID 83135088
2-(4-bromo-3-methylphenoxy)ethanesulfonamide (PubChem CID 83135088) has the molecular formula C9H12BrNO3S and a molecular weight of 294.17 g/mol. Its IUPAC name is 2-(4-bromo-3-methylphenoxy)ethanesulfonamide.
| Compound Name | 2-(4-bromo-3-methylphenoxy)ethanesulfonamide |
|---|---|
| PubChem CID | 83135088 |
| Molecular Formula | C9H12BrNO3S |
| Molecular Weight | 294.17 g/mol |
| Exact Mass | 292.97 |
| IUPAC Name | 2-(4-bromo-3-methylphenoxy)ethanesulfonamide |
| SMILES | Cc1cc(OCCS(N)(=O)=O)ccc1Br |
| InChI | InChI=1S/C9H12BrNO3S/c1-7-6-8(2-3-9(7)10)14-4-5-15(11,12)13/h2-3,6H,4-5H2,1H3,(H2,11,12,13) |
| InChIKey | BYTOULDHJJTKNO-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.17 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |