C11H14BF3O4 — CID 104706122
[5-methoxy-2-(4,4,4-trifluorobutoxy)phenyl]boronic acid (PubChem CID 104706122) has the molecular formula C11H14BF3O4 and a molecular weight of 278.03 g/mol. Its IUPAC name is [5-methoxy-2-(4,4,4-trifluorobutoxy)phenyl]boronic acid.
| Compound Name | [5-methoxy-2-(4,4,4-trifluorobutoxy)phenyl]boronic acid |
|---|---|
| PubChem CID | 104706122 |
| Molecular Formula | C11H14BF3O4 |
| Molecular Weight | 278.03 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | [5-methoxy-2-(4,4,4-trifluorobutoxy)phenyl]boronic acid |
| SMILES | COc1ccc(OCCCC(F)(F)F)c(B(O)O)c1 |
| InChI | InChI=1S/C11H14BF3O4/c1-18-8-3-4-10(9(7-8)12(16)17)19-6-2-5-11(13,14)15/h3-4,7,16-17H,2,5-6H2,1H3 |
| InChIKey | GJUXHHFMULQBHW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.03 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|