[5-methoxy-2-(4,4,4-trifluorobutoxy)phenyl]boronic acid

C11H14BF3O4 — CID 104706122

IUPAC[5-methoxy-2-(4,4,4-trifluorobutoxy)phenyl]boronic acid
SMILESCOc1ccc(OCCCC(F)(F)F)c(B(O)O)c1
InChIInChI=1S/C11H14BF3O4/c1-18-8-3-4-10(9(7-8)12(16)17)19-6-2-5-11(13,14)15/h3-4,7,16-17H,2,5-6H2,1H3
InChIKeyGJUXHHFMULQBHW-UHFFFAOYSA-N
MW278.03 g/mol
LogP1.10
Rot. Bonds6

About [5-methoxy-2-(4,4,4-trifluorobutoxy)phenyl]boronic acid

[5-methoxy-2-(4,4,4-trifluorobutoxy)phenyl]boronic acid (PubChem CID 104706122) has the molecular formula C11H14BF3O4 and a molecular weight of 278.03 g/mol. Its IUPAC name is [5-methoxy-2-(4,4,4-trifluorobutoxy)phenyl]boronic acid.

Molecular Properties

Compound Name[5-methoxy-2-(4,4,4-trifluorobutoxy)phenyl]boronic acid
PubChem CID104706122
Molecular FormulaC11H14BF3O4
Molecular Weight278.03 g/mol
Exact Mass278.09
IUPAC Name[5-methoxy-2-(4,4,4-trifluorobutoxy)phenyl]boronic acid
SMILESCOc1ccc(OCCCC(F)(F)F)c(B(O)O)c1
InChIInChI=1S/C11H14BF3O4/c1-18-8-3-4-10(9(7-8)12(16)17)19-6-2-5-11(13,14)15/h3-4,7,16-17H,2,5-6H2,1H3
InChIKeyGJUXHHFMULQBHW-UHFFFAOYSA-N
XLogP1.10
TPSA58.92 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.03
LogP ≤ 51.10
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [5-methoxy-2-(4,4,4-trifluorobutoxy)phenyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [5-methoxy-2-(4,4,4-trifluorobutoxy)phenyl]boronic acid?
The IUPAC name of [5-methoxy-2-(4,4,4-trifluorobutoxy)phenyl]boronic acid (CID 104706122) is [5-methoxy-2-(4,4,4-trifluorobutoxy)phenyl]boronic acid.
What is the SMILES notation for [5-methoxy-2-(4,4,4-trifluorobutoxy)phenyl]boronic acid?
The canonical SMILES for [5-methoxy-2-(4,4,4-trifluorobutoxy)phenyl]boronic acid is COc1ccc(OCCCC(F)(F)F)c(B(O)O)c1.
What is the InChIKey of [5-methoxy-2-(4,4,4-trifluorobutoxy)phenyl]boronic acid?
The InChIKey is GJUXHHFMULQBHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14BF3O4/c1-18-8-3-4-10(9(7-8)12(16)17)19-6-2-5-11(13,14)15/h3-4,7,16-17H,2,5-6H2,1H3.
What are the key properties of [5-methoxy-2-(4,4,4-trifluorobutoxy)phenyl]boronic acid?
[5-methoxy-2-(4,4,4-trifluorobutoxy)phenyl]boronic acid has a molecular weight of 278.03 g/mol, XLogP of 1.10, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-methoxy-2-(4,4,4-trifluorobutoxy)phenyl]boronic acid is sourced from PubChem (CID 104706122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).