C10H11BF4O3 — CID 115514513
[4-fluoro-2-(4,4,4-trifluorobutoxy)phenyl]boronic acid (PubChem CID 115514513) has the molecular formula C10H11BF4O3 and a molecular weight of 266.00 g/mol. Its IUPAC name is [4-fluoro-2-(4,4,4-trifluorobutoxy)phenyl]boronic acid.
| Compound Name | [4-fluoro-2-(4,4,4-trifluorobutoxy)phenyl]boronic acid |
|---|---|
| PubChem CID | 115514513 |
| Molecular Formula | C10H11BF4O3 |
| Molecular Weight | 266.00 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | [4-fluoro-2-(4,4,4-trifluorobutoxy)phenyl]boronic acid |
| SMILES | OB(O)c1ccc(F)cc1OCCCC(F)(F)F |
| InChI | InChI=1S/C10H11BF4O3/c12-7-2-3-8(11(16)17)9(6-7)18-5-1-4-10(13,14)15/h2-3,6,16-17H,1,4-5H2 |
| InChIKey | UVOCQJQOFMWJAM-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.00 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|