C11H12F4O2 — CID 64566512
1-[4-fluoro-2-(3,3,3-trifluoropropoxy)phenyl]ethanol (PubChem CID 64566512) has the molecular formula C11H12F4O2 and a molecular weight of 252.21 g/mol. Its IUPAC name is 1-[4-fluoro-2-(3,3,3-trifluoropropoxy)phenyl]ethanol.
| Compound Name | 1-[4-fluoro-2-(3,3,3-trifluoropropoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 64566512 |
| Molecular Formula | C11H12F4O2 |
| Molecular Weight | 252.21 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 1-[4-fluoro-2-(3,3,3-trifluoropropoxy)phenyl]ethanol |
| SMILES | CC(O)c1ccc(F)cc1OCCC(F)(F)F |
| InChI | InChI=1S/C11H12F4O2/c1-7(16)9-3-2-8(12)6-10(9)17-5-4-11(13,14)15/h2-3,6-7,16H,4-5H2,1H3 |
| InChIKey | VRTABQQAOGXCLO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.21 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |