C12H17FO4S — CID 78932553
(1S)-1-[2-(2-ethylsulfonylethoxy)-4-fluorophenyl]ethanol (PubChem CID 78932553) has the molecular formula C12H17FO4S and a molecular weight of 276.33 g/mol. Its IUPAC name is (1S)-1-[2-(2-ethylsulfonylethoxy)-4-fluorophenyl]ethanol.
| Compound Name | (1S)-1-[2-(2-ethylsulfonylethoxy)-4-fluorophenyl]ethanol |
|---|---|
| PubChem CID | 78932553 |
| Molecular Formula | C12H17FO4S |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | (1S)-1-[2-(2-ethylsulfonylethoxy)-4-fluorophenyl]ethanol |
| SMILES | CCS(=O)(=O)CCOc1cc(F)ccc1[C@H](C)O |
| InChI | InChI=1S/C12H17FO4S/c1-3-18(15,16)7-6-17-12-8-10(13)4-5-11(12)9(2)14/h4-5,8-9,14H,3,6-7H2,1-2H3/t9-/m0/s1 |
| InChIKey | HMYJUCLDRQKDKS-VIFPVBQESA-N |
| XLogP | 1.69 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |