C10H12BF4KO3S — CID 106726802
potassium [2-(2-ethylsulfonylethoxy)-4-fluorophenyl]-trifluoroboranuide (PubChem CID 106726802) has the molecular formula C10H12BF4KO3S and a molecular weight of 338.17 g/mol. Its IUPAC name is potassium [2-(2-ethylsulfonylethoxy)-4-fluorophenyl]-trifluoroboranuide.
| Compound Name | potassium [2-(2-ethylsulfonylethoxy)-4-fluorophenyl]-trifluoroboranuide |
|---|---|
| PubChem CID | 106726802 |
| Molecular Formula | C10H12BF4KO3S |
| Molecular Weight | 338.17 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | potassium [2-(2-ethylsulfonylethoxy)-4-fluorophenyl]-trifluoroboranuide |
| SMILES | CCS(=O)(=O)CCOc1cc(F)ccc1[B-](F)(F)F.[K+] |
| InChI | InChI=1S/C10H12BF4O3S.K/c1-2-19(16,17)6-5-18-10-7-8(12)3-4-9(10)11(13,14)15;/h3-4,7H,2,5-6H2,1H3;/q-1;+1 |
| InChIKey | SXKRUTAXLTVIHP-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.17 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|