C9H7BF7KO2 — CID 106705328
potassium trifluoro-[4-fluoro-2-(2,2,2-trifluoroethoxymethoxy)phenyl]boranuide (PubChem CID 106705328) has the molecular formula C9H7BF7KO2 and a molecular weight of 330.05 g/mol. Its IUPAC name is potassium trifluoro-[4-fluoro-2-(2,2,2-trifluoroethoxymethoxy)phenyl]boranuide.
| Compound Name | potassium trifluoro-[4-fluoro-2-(2,2,2-trifluoroethoxymethoxy)phenyl]boranuide |
|---|---|
| PubChem CID | 106705328 |
| Molecular Formula | C9H7BF7KO2 |
| Molecular Weight | 330.05 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | potassium trifluoro-[4-fluoro-2-(2,2,2-trifluoroethoxymethoxy)phenyl]boranuide |
| SMILES | Fc1ccc([B-](F)(F)F)c(OCOCC(F)(F)F)c1.[K+] |
| InChI | InChI=1S/C9H7BF7O2.K/c11-6-1-2-7(10(15,16)17)8(3-6)19-5-18-4-9(12,13)14;/h1-3H,4-5H2;/q-1;+1 |
| InChIKey | ZAVZTTKHBWUNOF-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.05 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|