C9H8BF6O2- — CID 106705309
trifluoro-[2-(2,2,2-trifluoroethoxymethoxy)phenyl]boranuide (PubChem CID 106705309) has the molecular formula C9H8BF6O2- and a molecular weight of 272.96 g/mol. Its IUPAC name is trifluoro-[2-(2,2,2-trifluoroethoxymethoxy)phenyl]boranuide.
| Compound Name | trifluoro-[2-(2,2,2-trifluoroethoxymethoxy)phenyl]boranuide |
|---|---|
| PubChem CID | 106705309 |
| Molecular Formula | C9H8BF6O2- |
| Molecular Weight | 272.96 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | trifluoro-[2-(2,2,2-trifluoroethoxymethoxy)phenyl]boranuide |
| SMILES | F[B-](F)(F)c1ccccc1OCOCC(F)(F)F |
| InChI | InChI=1S/C9H8BF6O2/c11-9(12,13)5-17-6-18-8-4-2-1-3-7(8)10(14,15)16/h1-4H,5-6H2/q-1 |
| InChIKey | MGONCUTWDNAWBK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.96 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|