C8H6BF6O- — CID 55233972
trifluoro-[2-(2,2,2-trifluoroethoxy)phenyl]boranuide (PubChem CID 55233972) has the molecular formula C8H6BF6O- and a molecular weight of 242.94 g/mol. Its IUPAC name is trifluoro-[2-(2,2,2-trifluoroethoxy)phenyl]boranuide.
| Compound Name | trifluoro-[2-(2,2,2-trifluoroethoxy)phenyl]boranuide |
|---|---|
| PubChem CID | 55233972 |
| Molecular Formula | C8H6BF6O- |
| Molecular Weight | 242.94 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | trifluoro-[2-(2,2,2-trifluoroethoxy)phenyl]boranuide |
| SMILES | F[B-](F)(F)c1ccccc1OCC(F)(F)F |
| InChI | InChI=1S/C8H6BF6O/c10-8(11,12)5-16-7-4-2-1-3-6(7)9(13,14)15/h1-4H,5H2/q-1 |
| InChIKey | XFSZLEJSJCLCMM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.94 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|