About ethane;1-propyl-2-(2,2,2-trifluoroethoxy)benzene
ethane;1-propyl-2-(2,2,2-trifluoroethoxy)benzene (PubChem CID 142580801) has the molecular formula C13H19F3O
and a molecular weight of 248.29 g/mol. Its IUPAC name is ethane;1-propyl-2-(2,2,2-trifluoroethoxy)benzene.
Molecular Properties
| Compound Name | ethane;1-propyl-2-(2,2,2-trifluoroethoxy)benzene |
| PubChem CID | 142580801 |
| Molecular Formula | C13H19F3O |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | ethane;1-propyl-2-(2,2,2-trifluoroethoxy)benzene |
| SMILES | CC.CCCc1ccccc1OCC(F)(F)F |
| InChI | InChI=1S/C11H13F3O.C2H6/c1-2-5-9-6-3-4-7-10(9)15-8-11(12,13)14;1-2/h3-4,6-7H,2,5,8H2,1H3;1-2H3 |
| InChIKey | UDNLVTIHZXYKGA-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;1-propyl-2-(2,2,2-trifluoroethoxy)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-propyl-2-(2,2,2-trifluoroethoxy)benzene?
The IUPAC name of ethane;1-propyl-2-(2,2,2-trifluoroethoxy)benzene (CID 142580801) is ethane;1-propyl-2-(2,2,2-trifluoroethoxy)benzene.
What is the SMILES notation for ethane;1-propyl-2-(2,2,2-trifluoroethoxy)benzene?
The canonical SMILES for ethane;1-propyl-2-(2,2,2-trifluoroethoxy)benzene is CC.CCCc1ccccc1OCC(F)(F)F.
What is the InChIKey of ethane;1-propyl-2-(2,2,2-trifluoroethoxy)benzene?
The InChIKey is UDNLVTIHZXYKGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F3O.C2H6/c1-2-5-9-6-3-4-7-10(9)15-8-11(12,13)14;1-2/h3-4,6-7H,2,5,8H2,1H3;1-2H3.
What are the key properties of ethane;1-propyl-2-(2,2,2-trifluoroethoxy)benzene?
ethane;1-propyl-2-(2,2,2-trifluoroethoxy)benzene has a molecular weight of 248.29 g/mol, XLogP of 4.61, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-propyl-2-(2,2,2-trifluoroethoxy)benzene is sourced from PubChem (CID 142580801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).