C14H19Cl3O — CID 54232369
1-hexyl-2-(2,2,2-trichloroethoxy)benzene (PubChem CID 54232369) has the molecular formula C14H19Cl3O and a molecular weight of 309.66 g/mol. Its IUPAC name is 1-hexyl-2-(2,2,2-trichloroethoxy)benzene.
| Compound Name | 1-hexyl-2-(2,2,2-trichloroethoxy)benzene |
|---|---|
| PubChem CID | 54232369 |
| Molecular Formula | C14H19Cl3O |
| Molecular Weight | 309.66 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 1-hexyl-2-(2,2,2-trichloroethoxy)benzene |
| SMILES | CCCCCCc1ccccc1OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H19Cl3O/c1-2-3-4-5-8-12-9-6-7-10-13(12)18-11-14(15,16)17/h6-7,9-10H,2-5,8,11H2,1H3 |
| InChIKey | QKECWPIQPVCCJW-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.66 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|