C9H9ClF3NO2 — CID 160645363
2-(2,2,2-trifluoroethoxy)benzamide;hydrochloride (PubChem CID 160645363) has the molecular formula C9H9ClF3NO2 and a molecular weight of 255.62 g/mol. Its IUPAC name is 2-(2,2,2-trifluoroethoxy)benzamide;hydrochloride.
| Compound Name | 2-(2,2,2-trifluoroethoxy)benzamide;hydrochloride |
|---|---|
| PubChem CID | 160645363 |
| Molecular Formula | C9H9ClF3NO2 |
| Molecular Weight | 255.62 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 2-(2,2,2-trifluoroethoxy)benzamide;hydrochloride |
| SMILES | Cl.NC(=O)c1ccccc1OCC(F)(F)F |
| InChI | InChI=1S/C9H8F3NO2.ClH/c10-9(11,12)5-15-7-4-2-1-3-6(7)8(13)14;/h1-4H,5H2,(H2,13,14);1H |
| InChIKey | RJSHZZFRUNWKMR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.62 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |