C9H6F3NaO3 — CID 23667245
sodium 2-(2,2,2-trifluoroethoxy)benzoate (PubChem CID 23667245) has the molecular formula C9H6F3NaO3 and a molecular weight of 242.13 g/mol. Its IUPAC name is sodium 2-(2,2,2-trifluoroethoxy)benzoate.
| Compound Name | sodium 2-(2,2,2-trifluoroethoxy)benzoate |
|---|---|
| PubChem CID | 23667245 |
| Molecular Formula | C9H6F3NaO3 |
| Molecular Weight | 242.13 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | sodium 2-(2,2,2-trifluoroethoxy)benzoate |
| SMILES | O=C([O-])c1ccccc1OCC(F)(F)F.[Na+] |
| InChI | InChI=1S/C9H7F3O3.Na/c10-9(11,12)5-15-7-4-2-1-3-6(7)8(13)14;/h1-4H,5H2,(H,13,14);/q;+1/p-1 |
| InChIKey | KCTSIZZMZQTUJC-UHFFFAOYSA-M |
| XLogP | -2.00 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.13 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |