About mercury;2-phenylsulfanyloxybenzoate
mercury;2-phenylsulfanyloxybenzoate (PubChem CID 3029288) has the molecular formula C13H9HgO3S-
and a molecular weight of 445.87 g/mol. Its IUPAC name is mercury;2-phenylsulfanyloxybenzoate.
Molecular Properties
| Compound Name | mercury;2-phenylsulfanyloxybenzoate |
| PubChem CID | 3029288 |
| Molecular Formula | C13H9HgO3S- |
| Molecular Weight | 445.87 g/mol |
| Exact Mass | 447.00 |
| IUPAC Name | mercury;2-phenylsulfanyloxybenzoate |
| SMILES | O=C([O-])c1ccccc1OSc1ccccc1.[Hg] |
| InChI | InChI=1S/C13H10O3S.Hg/c14-13(15)11-8-4-5-9-12(11)16-17-10-6-2-1-3-7-10;/h1-9H,(H,14,15);/p-1 |
| InChIKey | LXTMBXRCJSCQOM-UHFFFAOYSA-M |
| XLogP | 2.13 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 445.87 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze mercury;2-phenylsulfanyloxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of mercury;2-phenylsulfanyloxybenzoate?
The IUPAC name of mercury;2-phenylsulfanyloxybenzoate (CID 3029288) is mercury;2-phenylsulfanyloxybenzoate.
What is the SMILES notation for mercury;2-phenylsulfanyloxybenzoate?
The canonical SMILES for mercury;2-phenylsulfanyloxybenzoate is O=C([O-])c1ccccc1OSc1ccccc1.[Hg].
What is the InChIKey of mercury;2-phenylsulfanyloxybenzoate?
The InChIKey is LXTMBXRCJSCQOM-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H10O3S.Hg/c14-13(15)11-8-4-5-9-12(11)16-17-10-6-2-1-3-7-10;/h1-9H,(H,14,15);/p-1.
What are the key properties of mercury;2-phenylsulfanyloxybenzoate?
mercury;2-phenylsulfanyloxybenzoate has a molecular weight of 445.87 g/mol, XLogP of 2.13, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for mercury;2-phenylsulfanyloxybenzoate is sourced from PubChem (CID 3029288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).