About sodium;2-acetyloxybenzoate;carbonic acid
sodium;2-acetyloxybenzoate;carbonic acid (PubChem CID 66790092) has the molecular formula C10H9NaO7
and a molecular weight of 264.16 g/mol. Its IUPAC name is sodium;2-acetyloxybenzoate;carbonic acid.
Molecular Properties
| Compound Name | sodium;2-acetyloxybenzoate;carbonic acid |
| PubChem CID | 66790092 |
| Molecular Formula | C10H9NaO7 |
| Molecular Weight | 264.16 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | sodium;2-acetyloxybenzoate;carbonic acid |
| SMILES | CC(=O)Oc1ccccc1C(=O)[O-].O=C(O)O.[Na+] |
| InChI | InChI=1S/C9H8O4.CH2O3.Na/c1-6(10)13-8-5-3-2-4-7(8)9(11)12;2-1(3)4;/h2-5H,1H3,(H,11,12);(H2,2,3,4);/q;;+1/p-1 |
| InChIKey | BBGNSKKJRRGKHL-UHFFFAOYSA-M |
| XLogP | -2.80 |
| TPSA | 123.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.16 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze sodium;2-acetyloxybenzoate;carbonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-acetyloxybenzoate;carbonic acid?
The IUPAC name of sodium;2-acetyloxybenzoate;carbonic acid (CID 66790092) is sodium;2-acetyloxybenzoate;carbonic acid.
What is the SMILES notation for sodium;2-acetyloxybenzoate;carbonic acid?
The canonical SMILES for sodium;2-acetyloxybenzoate;carbonic acid is CC(=O)Oc1ccccc1C(=O)[O-].O=C(O)O.[Na+].
What is the InChIKey of sodium;2-acetyloxybenzoate;carbonic acid?
The InChIKey is BBGNSKKJRRGKHL-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H8O4.CH2O3.Na/c1-6(10)13-8-5-3-2-4-7(8)9(11)12;2-1(3)4;/h2-5H,1H3,(H,11,12);(H2,2,3,4);/q;;+1/p-1.
What are the key properties of sodium;2-acetyloxybenzoate;carbonic acid?
sodium;2-acetyloxybenzoate;carbonic acid has a molecular weight of 264.16 g/mol, XLogP of -2.80, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-acetyloxybenzoate;carbonic acid is sourced from PubChem (CID 66790092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).